C25H31NO8 — CID 90375986
(E)-4-[[(6aR,10aR)-6,6,9-trimethyl-3-(5-nitrooxypentyl)-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl]oxy]-4-oxobut-2-enoic acid (PubChem CID 90375986) has the molecular formula C25H31NO8 and a molecular weight of 473.52 g/mol. Its IUPAC name is (E)-4-[[(6aR,10aR)-6,6,9-trimethyl-3-(5-nitrooxypentyl)-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl]oxy]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[[(6aR,10aR)-6,6,9-trimethyl-3-(5-nitrooxypentyl)-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl]oxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 90375986 |
| Molecular Formula | C25H31NO8 |
| Molecular Weight | 473.52 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | (E)-4-[[(6aR,10aR)-6,6,9-trimethyl-3-(5-nitrooxypentyl)-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl]oxy]-4-oxobut-2-enoic acid |
| SMILES | CC1=C[C@H]2c3c(OC(=O)/C=C/C(=O)O)cc(CCCCCO[N+](=O)[O-])cc3OC(C)(C)[C@@H]2CC1 |
| InChI | InChI=1S/C25H31NO8/c1-16-8-9-19-18(13-16)24-20(33-23(29)11-10-22(27)28)14-17(15-21(24)34-25(19,2)3)7-5-4-6-12-32-26(30)31/h10-11,13-15,18-19H,4-9,12H2,1-3H3,(H,27,28)/b11-10+/t18-,19-/m1/s1 |
| InChIKey | QGVDTULZQPUKKX-MMKWGKFASA-N |
| XLogP | 4.76 |
| TPSA | 125.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.52 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|