C19H25NO5 — CID 90376021
5-[(6aS,10aS)-6-hydroxy-9-methyl-6a,7,10,10a-tetrahydro-6H-benzo[c]chromen-3-yl]pentyl nitrate (PubChem CID 90376021) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is 5-[(6aS,10aS)-6-hydroxy-9-methyl-6a,7,10,10a-tetrahydro-6H-benzo[c]chromen-3-yl]pentyl nitrate.
| Compound Name | 5-[(6aS,10aS)-6-hydroxy-9-methyl-6a,7,10,10a-tetrahydro-6H-benzo[c]chromen-3-yl]pentyl nitrate |
|---|---|
| PubChem CID | 90376021 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 5-[(6aS,10aS)-6-hydroxy-9-methyl-6a,7,10,10a-tetrahydro-6H-benzo[c]chromen-3-yl]pentyl nitrate |
| SMILES | CC1=CC[C@@H]2C(O)Oc3cc(CCCCCO[N+](=O)[O-])ccc3[C@H]2C1 |
| InChI | InChI=1S/C19H25NO5/c1-13-6-8-16-17(11-13)15-9-7-14(12-18(15)25-19(16)21)5-3-2-4-10-24-20(22)23/h6-7,9,12,16-17,19,21H,2-5,8,10-11H2,1H3/t16-,17+,19?/m0/s1 |
| InChIKey | SXWFAWVYZGLFCX-PZEDNMLSSA-N |
| XLogP | 3.76 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|