C46H54F4NO9+ — CID 90376079
bis[7-[3,5-dihydroxy-4-(5-methoxy-2-prop-1-en-2-ylphenyl)phenyl]-7,7-difluoroheptoxy]-oxoazanium (PubChem CID 90376079) has the molecular formula C46H54F4NO9+ and a molecular weight of 840.93 g/mol. Its IUPAC name is bis[7-[3,5-dihydroxy-4-(5-methoxy-2-prop-1-en-2-ylphenyl)phenyl]-7,7-difluoroheptoxy]-oxoazanium.
| Compound Name | bis[7-[3,5-dihydroxy-4-(5-methoxy-2-prop-1-en-2-ylphenyl)phenyl]-7,7-difluoroheptoxy]-oxoazanium |
|---|---|
| PubChem CID | 90376079 |
| Molecular Formula | C46H54F4NO9+ |
| Molecular Weight | 840.93 g/mol |
| Exact Mass | 840.37 |
| IUPAC Name | bis[7-[3,5-dihydroxy-4-(5-methoxy-2-prop-1-en-2-ylphenyl)phenyl]-7,7-difluoroheptoxy]-oxoazanium |
| SMILES | C=C(C)c1ccc(OC)cc1-c1c(O)cc(C(F)(F)CCCCCCO[N+](=O)OCCCCCCC(F)(F)c2cc(O)c(-c3cc(OC)ccc3C(=C)C)c(O)c2)cc1O |
| InChI | InChI=1S/C46H53F4NO9/c1-29(2)35-17-15-33(57-5)27-37(35)43-39(52)23-31(24-40(43)53)45(47,48)19-11-7-9-13-21-59-51(56)60-22-14-10-8-12-20-46(49,50)32-25-41(54)44(42(55)26-32)38-28-34(58-6)16-18-36(38)30(3)4/h15-18,23-28H,1,3,7-14,19-22H2,2,4-6H3,(H3-,52,53,54,55)/p+1 |
| InChIKey | LZMMSVPLLFSAJS-UHFFFAOYSA-O |
| XLogP | 12.35 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.93 |
| LogP ≤ 5 | 12.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|