C26H35F2NO6 — CID 90376211
[3-(1,1-difluorohexyl)-6,6,9-trimethyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl] 4-nitrooxybutanoate (PubChem CID 90376211) has the molecular formula C26H35F2NO6 and a molecular weight of 495.56 g/mol. Its IUPAC name is [3-(1,1-difluorohexyl)-6,6,9-trimethyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl] 4-nitrooxybutanoate.
| Compound Name | [3-(1,1-difluorohexyl)-6,6,9-trimethyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl] 4-nitrooxybutanoate |
|---|---|
| PubChem CID | 90376211 |
| Molecular Formula | C26H35F2NO6 |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | [3-(1,1-difluorohexyl)-6,6,9-trimethyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl] 4-nitrooxybutanoate |
| SMILES | CCCCCC(F)(F)c1cc(OC(=O)CCCO[N+](=O)[O-])c2c(c1)OC(C)(C)C1CCC(C)=CC21 |
| InChI | InChI=1S/C26H35F2NO6/c1-5-6-7-12-26(27,28)18-15-21(34-23(30)9-8-13-33-29(31)32)24-19-14-17(2)10-11-20(19)25(3,4)35-22(24)16-18/h14-16,19-20H,5-13H2,1-4H3 |
| InChIKey | VQLWZGUUAIHJTH-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|