C29H28F4N4O2 — CID 90376447
N-[3-[(4R,6S)-2-anilino-4-methyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-4-yl]-4-fluorophenyl]-4-(2-cyclopropylethynyl)-3,6-dihydro-2H-pyridine-1-carboxamide (PubChem CID 90376447) has the molecular formula C29H28F4N4O2 and a molecular weight of 540.56 g/mol. Its IUPAC name is N-[3-[(4R,6S)-2-anilino-4-methyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-4-yl]-4-fluorophenyl]-4-(2-cyclopropylethynyl)-3,6-dihydro-2H-pyridine-1-carboxamide.
| Compound Name | N-[3-[(4R,6S)-2-anilino-4-methyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-4-yl]-4-fluorophenyl]-4-(2-cyclopropylethynyl)-3,6-dihydro-2H-pyridine-1-carboxamide |
|---|---|
| PubChem CID | 90376447 |
| Molecular Formula | C29H28F4N4O2 |
| Molecular Weight | 540.56 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | N-[3-[(4R,6S)-2-anilino-4-methyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-4-yl]-4-fluorophenyl]-4-(2-cyclopropylethynyl)-3,6-dihydro-2H-pyridine-1-carboxamide |
| SMILES | C[C@]1(c2cc(NC(=O)N3CC=C(C#CC4CC4)CC3)ccc2F)C[C@@H](C(F)(F)F)OC(Nc2ccccc2)=N1 |
| InChI | InChI=1S/C29H28F4N4O2/c1-28(18-25(29(31,32)33)39-26(36-28)34-21-5-3-2-4-6-21)23-17-22(11-12-24(23)30)35-27(38)37-15-13-20(14-16-37)10-9-19-7-8-19/h2-6,11-13,17,19,25H,7-8,14-16,18H2,1H3,(H,34,36)(H,35,38)/t25-,28+/m0/s1 |
| InChIKey | UKTAUXSNTOYDRX-LBNVMWSVSA-N |
| XLogP | 6.44 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.56 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|