2-(1,4-dioxaspiro[4.5]decan-8-ylidene)butanoic acid

C12H18O4 — CID 90376622

IUPAC2-(1,4-dioxaspiro[4.5]decan-8-ylidene)butanoic acid
SMILESCCC(C(=O)O)=C1CCC2(CC1)OCCO2
InChIInChI=1S/C12H18O4/c1-2-10(11(13)14)9-3-5-12(6-4-9)15-7-8-16-12/h2-8H2,1H3,(H,13,14)
InChIKeyVNMVQZKMRJNCGP-UHFFFAOYSA-N
MW226.27 g/mol
LogP2.09
Rot. Bonds2

About 2-(1,4-dioxaspiro[4.5]decan-8-ylidene)butanoic acid

2-(1,4-dioxaspiro[4.5]decan-8-ylidene)butanoic acid (PubChem CID 90376622) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is 2-(1,4-dioxaspiro[4.5]decan-8-ylidene)butanoic acid.

Molecular Properties

Compound Name2-(1,4-dioxaspiro[4.5]decan-8-ylidene)butanoic acid
PubChem CID90376622
Molecular FormulaC12H18O4
Molecular Weight226.27 g/mol
Exact Mass226.12
IUPAC Name2-(1,4-dioxaspiro[4.5]decan-8-ylidene)butanoic acid
SMILESCCC(C(=O)O)=C1CCC2(CC1)OCCO2
InChIInChI=1S/C12H18O4/c1-2-10(11(13)14)9-3-5-12(6-4-9)15-7-8-16-12/h2-8H2,1H3,(H,13,14)
InChIKeyVNMVQZKMRJNCGP-UHFFFAOYSA-N
XLogP2.09
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.27
LogP ≤ 52.09
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-(1,4-dioxaspiro[4.5]decan-8-ylidene)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,4-dioxaspiro[4.5]decan-8-ylidene)butanoic acid?
The IUPAC name of 2-(1,4-dioxaspiro[4.5]decan-8-ylidene)butanoic acid (CID 90376622) is 2-(1,4-dioxaspiro[4.5]decan-8-ylidene)butanoic acid.
What is the SMILES notation for 2-(1,4-dioxaspiro[4.5]decan-8-ylidene)butanoic acid?
The canonical SMILES for 2-(1,4-dioxaspiro[4.5]decan-8-ylidene)butanoic acid is CCC(C(=O)O)=C1CCC2(CC1)OCCO2.
What is the InChIKey of 2-(1,4-dioxaspiro[4.5]decan-8-ylidene)butanoic acid?
The InChIKey is VNMVQZKMRJNCGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O4/c1-2-10(11(13)14)9-3-5-12(6-4-9)15-7-8-16-12/h2-8H2,1H3,(H,13,14).
What are the key properties of 2-(1,4-dioxaspiro[4.5]decan-8-ylidene)butanoic acid?
2-(1,4-dioxaspiro[4.5]decan-8-ylidene)butanoic acid has a molecular weight of 226.27 g/mol, XLogP of 2.09, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,4-dioxaspiro[4.5]decan-8-ylidene)butanoic acid is sourced from PubChem (CID 90376622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).