C31H49BrO4Si — CID 90376704
(10aS)-3-(8-bromo-2-methyloctan-2-yl)-1-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromene-9-carboxylic acid (PubChem CID 90376704) has the molecular formula C31H49BrO4Si and a molecular weight of 593.72 g/mol. Its IUPAC name is (10aS)-3-(8-bromo-2-methyloctan-2-yl)-1-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromene-9-carboxylic acid.
| Compound Name | (10aS)-3-(8-bromo-2-methyloctan-2-yl)-1-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromene-9-carboxylic acid |
|---|---|
| PubChem CID | 90376704 |
| Molecular Formula | C31H49BrO4Si |
| Molecular Weight | 593.72 g/mol |
| Exact Mass | 592.26 |
| IUPAC Name | (10aS)-3-(8-bromo-2-methyloctan-2-yl)-1-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromene-9-carboxylic acid |
| SMILES | CC(C)(CCCCCCBr)c1cc2c(c(O[Si](C)(C)C(C)(C)C)c1)[C@H]1CC(C(=O)O)=CCC1C(C)(C)O2 |
| InChI | InChI=1S/C31H49BrO4Si/c1-29(2,3)37(8,9)36-26-20-22(30(4,5)16-12-10-11-13-17-32)19-25-27(26)23-18-21(28(33)34)14-15-24(23)31(6,7)35-25/h14,19-20,23-24H,10-13,15-18H2,1-9H3,(H,33,34)/t23-,24?/m0/s1 |
| InChIKey | FMBBNDKMEUZZQW-UXMRNZNESA-N |
| XLogP | 9.37 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.72 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|