C23H31NO6 — CID 90376722
(6,6,9-trimethyl-3-propyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-yl) 4-nitrooxybutanoate (PubChem CID 90376722) has the molecular formula C23H31NO6 and a molecular weight of 417.50 g/mol. Its IUPAC name is (6,6,9-trimethyl-3-propyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-yl) 4-nitrooxybutanoate.
| Compound Name | (6,6,9-trimethyl-3-propyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-yl) 4-nitrooxybutanoate |
|---|---|
| PubChem CID | 90376722 |
| Molecular Formula | C23H31NO6 |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | (6,6,9-trimethyl-3-propyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-yl) 4-nitrooxybutanoate |
| SMILES | CCCc1cc(OC(=O)CCCO[N+](=O)[O-])c2c(c1)OC(C)(C)C1CC=C(C)CC21 |
| InChI | InChI=1S/C23H31NO6/c1-5-7-16-13-19(29-21(25)8-6-11-28-24(26)27)22-17-12-15(2)9-10-18(17)23(3,4)30-20(22)14-16/h9,13-14,17-18H,5-8,10-12H2,1-4H3 |
| InChIKey | YRDUFDDRCVBPBW-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|