C28H41NO3Si — CID 90377051
tert-butyl (2R,3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3-dimethylpyrrolidine-1-carboxylate (PubChem CID 90377051) has the molecular formula C28H41NO3Si and a molecular weight of 467.73 g/mol. Its IUPAC name is tert-butyl (2R,3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3-dimethylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3-dimethylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 90377051 |
| Molecular Formula | C28H41NO3Si |
| Molecular Weight | 467.73 g/mol |
| Exact Mass | 467.29 |
| IUPAC Name | tert-butyl (2R,3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3-dimethylpyrrolidine-1-carboxylate |
| SMILES | C[C@@H]1C[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N(C(=O)OC(C)(C)C)[C@@H]1C |
| InChI | InChI=1S/C28H41NO3Si/c1-21-19-23(29(22(21)2)26(30)32-27(3,4)5)20-31-33(28(6,7)8,24-15-11-9-12-16-24)25-17-13-10-14-18-25/h9-18,21-23H,19-20H2,1-8H3/t21-,22-,23+/m1/s1 |
| InChIKey | QSQUDLOUUPYHLC-ZLNRFVROSA-N |
| XLogP | 5.60 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.73 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|