About 3-methylsulfonyl-6,6a-dihydro-1aH-indeno[1,2-b]oxirene
3-methylsulfonyl-6,6a-dihydro-1aH-indeno[1,2-b]oxirene (PubChem CID 90377232) has the molecular formula C10H10O3S
and a molecular weight of 210.25 g/mol. Its IUPAC name is 3-methylsulfonyl-6,6a-dihydro-1aH-indeno[1,2-b]oxirene.
Molecular Properties
| Compound Name | 3-methylsulfonyl-6,6a-dihydro-1aH-indeno[1,2-b]oxirene |
| PubChem CID | 90377232 |
| Molecular Formula | C10H10O3S |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | 3-methylsulfonyl-6,6a-dihydro-1aH-indeno[1,2-b]oxirene |
| SMILES | CS(=O)(=O)c1ccc2c(c1)C1OC1C2 |
| InChI | InChI=1S/C10H10O3S/c1-14(11,12)7-3-2-6-4-9-10(13-9)8(6)5-7/h2-3,5,9-10H,4H2,1H3 |
| InChIKey | PXBINDCEWNJTLP-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-methylsulfonyl-6,6a-dihydro-1aH-indeno[1,2-b]oxirene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylsulfonyl-6,6a-dihydro-1aH-indeno[1,2-b]oxirene?
The IUPAC name of 3-methylsulfonyl-6,6a-dihydro-1aH-indeno[1,2-b]oxirene (CID 90377232) is 3-methylsulfonyl-6,6a-dihydro-1aH-indeno[1,2-b]oxirene.
What is the SMILES notation for 3-methylsulfonyl-6,6a-dihydro-1aH-indeno[1,2-b]oxirene?
The canonical SMILES for 3-methylsulfonyl-6,6a-dihydro-1aH-indeno[1,2-b]oxirene is CS(=O)(=O)c1ccc2c(c1)C1OC1C2.
What is the InChIKey of 3-methylsulfonyl-6,6a-dihydro-1aH-indeno[1,2-b]oxirene?
The InChIKey is PXBINDCEWNJTLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O3S/c1-14(11,12)7-3-2-6-4-9-10(13-9)8(6)5-7/h2-3,5,9-10H,4H2,1H3.
What are the key properties of 3-methylsulfonyl-6,6a-dihydro-1aH-indeno[1,2-b]oxirene?
3-methylsulfonyl-6,6a-dihydro-1aH-indeno[1,2-b]oxirene has a molecular weight of 210.25 g/mol, XLogP of 1.09, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylsulfonyl-6,6a-dihydro-1aH-indeno[1,2-b]oxirene is sourced from PubChem (CID 90377232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).