About methyl 2-[5-amino-2,4-bis(3,4-dimethylphenyl)-3-methylphenyl]-2-[(2-methylpropan-2-yl)oxy]acetate
methyl 2-[5-amino-2,4-bis(3,4-dimethylphenyl)-3-methylphenyl]-2-[(2-methylpropan-2-yl)oxy]acetate (PubChem CID 90377326) has the molecular formula C30H37NO3
and a molecular weight of 459.63 g/mol. Its IUPAC name is methyl 2-[5-amino-2,4-bis(3,4-dimethylphenyl)-3-methylphenyl]-2-[(2-methylpropan-2-yl)oxy]acetate.
Molecular Properties
| Compound Name | methyl 2-[5-amino-2,4-bis(3,4-dimethylphenyl)-3-methylphenyl]-2-[(2-methylpropan-2-yl)oxy]acetate |
| PubChem CID | 90377326 |
| Molecular Formula | C30H37NO3 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.28 |
| IUPAC Name | methyl 2-[5-amino-2,4-bis(3,4-dimethylphenyl)-3-methylphenyl]-2-[(2-methylpropan-2-yl)oxy]acetate |
| SMILES | COC(=O)C(OC(C)(C)C)c1cc(N)c(-c2ccc(C)c(C)c2)c(C)c1-c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C30H37NO3/c1-17-10-12-22(14-19(17)3)26-21(5)27(23-13-11-18(2)20(4)15-23)25(31)16-24(26)28(29(32)33-9)34-30(6,7)8/h10-16,28H,31H2,1-9H3 |
| InChIKey | LORGPAGTUDERQR-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[5-amino-2,4-bis(3,4-dimethylphenyl)-3-methylphenyl]-2-[(2-methylpropan-2-yl)oxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[5-amino-2,4-bis(3,4-dimethylphenyl)-3-methylphenyl]-2-[(2-methylpropan-2-yl)oxy]acetate?
The IUPAC name of methyl 2-[5-amino-2,4-bis(3,4-dimethylphenyl)-3-methylphenyl]-2-[(2-methylpropan-2-yl)oxy]acetate (CID 90377326) is methyl 2-[5-amino-2,4-bis(3,4-dimethylphenyl)-3-methylphenyl]-2-[(2-methylpropan-2-yl)oxy]acetate.
What is the SMILES notation for methyl 2-[5-amino-2,4-bis(3,4-dimethylphenyl)-3-methylphenyl]-2-[(2-methylpropan-2-yl)oxy]acetate?
The canonical SMILES for methyl 2-[5-amino-2,4-bis(3,4-dimethylphenyl)-3-methylphenyl]-2-[(2-methylpropan-2-yl)oxy]acetate is COC(=O)C(OC(C)(C)C)c1cc(N)c(-c2ccc(C)c(C)c2)c(C)c1-c1ccc(C)c(C)c1.
What is the InChIKey of methyl 2-[5-amino-2,4-bis(3,4-dimethylphenyl)-3-methylphenyl]-2-[(2-methylpropan-2-yl)oxy]acetate?
The InChIKey is LORGPAGTUDERQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H37NO3/c1-17-10-12-22(14-19(17)3)26-21(5)27(23-13-11-18(2)20(4)15-23)25(31)16-24(26)28(29(32)33-9)34-30(6,7)8/h10-16,28H,31H2,1-9H3.
What are the key properties of methyl 2-[5-amino-2,4-bis(3,4-dimethylphenyl)-3-methylphenyl]-2-[(2-methylpropan-2-yl)oxy]acetate?
methyl 2-[5-amino-2,4-bis(3,4-dimethylphenyl)-3-methylphenyl]-2-[(2-methylpropan-2-yl)oxy]acetate has a molecular weight of 459.63 g/mol, XLogP of 7.17, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[5-amino-2,4-bis(3,4-dimethylphenyl)-3-methylphenyl]-2-[(2-methylpropan-2-yl)oxy]acetate is sourced from PubChem (CID 90377326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).