About methyl (2S)-2-(3-amino-2,5-dimethylphenyl)-2-[(2-methylpropan-2-yl)oxy]acetate
methyl (2S)-2-(3-amino-2,5-dimethylphenyl)-2-[(2-methylpropan-2-yl)oxy]acetate (PubChem CID 90377375) has the molecular formula C15H23NO3
and a molecular weight of 265.35 g/mol. Its IUPAC name is methyl (2S)-2-(3-amino-2,5-dimethylphenyl)-2-[(2-methylpropan-2-yl)oxy]acetate.
Molecular Properties
| Compound Name | methyl (2S)-2-(3-amino-2,5-dimethylphenyl)-2-[(2-methylpropan-2-yl)oxy]acetate |
| PubChem CID | 90377375 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | methyl (2S)-2-(3-amino-2,5-dimethylphenyl)-2-[(2-methylpropan-2-yl)oxy]acetate |
| SMILES | COC(=O)[C@@H](OC(C)(C)C)c1cc(C)cc(N)c1C |
| InChI | InChI=1S/C15H23NO3/c1-9-7-11(10(2)12(16)8-9)13(14(17)18-6)19-15(3,4)5/h7-8,13H,16H2,1-6H3/t13-/m0/s1 |
| InChIKey | LRHDNNXHPUPLPE-ZDUSSCGKSA-N |
| XLogP | 2.91 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze methyl (2S)-2-(3-amino-2,5-dimethylphenyl)-2-[(2-methylpropan-2-yl)oxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-(3-amino-2,5-dimethylphenyl)-2-[(2-methylpropan-2-yl)oxy]acetate?
The IUPAC name of methyl (2S)-2-(3-amino-2,5-dimethylphenyl)-2-[(2-methylpropan-2-yl)oxy]acetate (CID 90377375) is methyl (2S)-2-(3-amino-2,5-dimethylphenyl)-2-[(2-methylpropan-2-yl)oxy]acetate.
What is the SMILES notation for methyl (2S)-2-(3-amino-2,5-dimethylphenyl)-2-[(2-methylpropan-2-yl)oxy]acetate?
The canonical SMILES for methyl (2S)-2-(3-amino-2,5-dimethylphenyl)-2-[(2-methylpropan-2-yl)oxy]acetate is COC(=O)[C@@H](OC(C)(C)C)c1cc(C)cc(N)c1C.
What is the InChIKey of methyl (2S)-2-(3-amino-2,5-dimethylphenyl)-2-[(2-methylpropan-2-yl)oxy]acetate?
The InChIKey is LRHDNNXHPUPLPE-ZDUSSCGKSA-N. The full InChI is InChI=1S/C15H23NO3/c1-9-7-11(10(2)12(16)8-9)13(14(17)18-6)19-15(3,4)5/h7-8,13H,16H2,1-6H3/t13-/m0/s1.
What are the key properties of methyl (2S)-2-(3-amino-2,5-dimethylphenyl)-2-[(2-methylpropan-2-yl)oxy]acetate?
methyl (2S)-2-(3-amino-2,5-dimethylphenyl)-2-[(2-methylpropan-2-yl)oxy]acetate has a molecular weight of 265.35 g/mol, XLogP of 2.91, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-(3-amino-2,5-dimethylphenyl)-2-[(2-methylpropan-2-yl)oxy]acetate is sourced from PubChem (CID 90377375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).