About methyl 2-[3-amino-2-bromo-4,6-bis(3,4-dimethylphenyl)-5-methylphenyl]-2-hydroxyacetate
methyl 2-[3-amino-2-bromo-4,6-bis(3,4-dimethylphenyl)-5-methylphenyl]-2-hydroxyacetate (PubChem CID 90377399) has the molecular formula C26H28BrNO3
and a molecular weight of 482.42 g/mol. Its IUPAC name is methyl 2-[3-amino-2-bromo-4,6-bis(3,4-dimethylphenyl)-5-methylphenyl]-2-hydroxyacetate.
Molecular Properties
| Compound Name | methyl 2-[3-amino-2-bromo-4,6-bis(3,4-dimethylphenyl)-5-methylphenyl]-2-hydroxyacetate |
| PubChem CID | 90377399 |
| Molecular Formula | C26H28BrNO3 |
| Molecular Weight | 482.42 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | methyl 2-[3-amino-2-bromo-4,6-bis(3,4-dimethylphenyl)-5-methylphenyl]-2-hydroxyacetate |
| SMILES | COC(=O)C(O)c1c(Br)c(N)c(-c2ccc(C)c(C)c2)c(C)c1-c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C26H28BrNO3/c1-13-7-9-18(11-15(13)3)20-17(5)21(19-10-8-14(2)16(4)12-19)24(28)23(27)22(20)25(29)26(30)31-6/h7-12,25,29H,28H2,1-6H3 |
| InChIKey | LJBIHMPLFDYYHV-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 482.42 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[3-amino-2-bromo-4,6-bis(3,4-dimethylphenyl)-5-methylphenyl]-2-hydroxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[3-amino-2-bromo-4,6-bis(3,4-dimethylphenyl)-5-methylphenyl]-2-hydroxyacetate?
The IUPAC name of methyl 2-[3-amino-2-bromo-4,6-bis(3,4-dimethylphenyl)-5-methylphenyl]-2-hydroxyacetate (CID 90377399) is methyl 2-[3-amino-2-bromo-4,6-bis(3,4-dimethylphenyl)-5-methylphenyl]-2-hydroxyacetate.
What is the SMILES notation for methyl 2-[3-amino-2-bromo-4,6-bis(3,4-dimethylphenyl)-5-methylphenyl]-2-hydroxyacetate?
The canonical SMILES for methyl 2-[3-amino-2-bromo-4,6-bis(3,4-dimethylphenyl)-5-methylphenyl]-2-hydroxyacetate is COC(=O)C(O)c1c(Br)c(N)c(-c2ccc(C)c(C)c2)c(C)c1-c1ccc(C)c(C)c1.
What is the InChIKey of methyl 2-[3-amino-2-bromo-4,6-bis(3,4-dimethylphenyl)-5-methylphenyl]-2-hydroxyacetate?
The InChIKey is LJBIHMPLFDYYHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H28BrNO3/c1-13-7-9-18(11-15(13)3)20-17(5)21(19-10-8-14(2)16(4)12-19)24(28)23(27)22(20)25(29)26(30)31-6/h7-12,25,29H,28H2,1-6H3.
What are the key properties of methyl 2-[3-amino-2-bromo-4,6-bis(3,4-dimethylphenyl)-5-methylphenyl]-2-hydroxyacetate?
methyl 2-[3-amino-2-bromo-4,6-bis(3,4-dimethylphenyl)-5-methylphenyl]-2-hydroxyacetate has a molecular weight of 482.42 g/mol, XLogP of 6.11, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[3-amino-2-bromo-4,6-bis(3,4-dimethylphenyl)-5-methylphenyl]-2-hydroxyacetate is sourced from PubChem (CID 90377399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).