About 2-(4-hydroxy-2,6-dimethyloxan-3-yl)oxy-6-methyl-2H-pyran-5-one
2-(4-hydroxy-2,6-dimethyloxan-3-yl)oxy-6-methyl-2H-pyran-5-one (PubChem CID 90378484) has the molecular formula C13H20O5
and a molecular weight of 256.30 g/mol. Its IUPAC name is 2-(4-hydroxy-2,6-dimethyloxan-3-yl)oxy-6-methyl-2H-pyran-5-one.
Molecular Properties
| Compound Name | 2-(4-hydroxy-2,6-dimethyloxan-3-yl)oxy-6-methyl-2H-pyran-5-one |
| PubChem CID | 90378484 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 2-(4-hydroxy-2,6-dimethyloxan-3-yl)oxy-6-methyl-2H-pyran-5-one |
| SMILES | CC1CC(O)C(OC2C=CC(=O)C(C)O2)C(C)O1 |
| InChI | InChI=1S/C13H20O5/c1-7-6-11(15)13(9(3)16-7)18-12-5-4-10(14)8(2)17-12/h4-5,7-9,11-13,15H,6H2,1-3H3 |
| InChIKey | CAGSIDQRMHZANM-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-hydroxy-2,6-dimethyloxan-3-yl)oxy-6-methyl-2H-pyran-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-hydroxy-2,6-dimethyloxan-3-yl)oxy-6-methyl-2H-pyran-5-one?
The IUPAC name of 2-(4-hydroxy-2,6-dimethyloxan-3-yl)oxy-6-methyl-2H-pyran-5-one (CID 90378484) is 2-(4-hydroxy-2,6-dimethyloxan-3-yl)oxy-6-methyl-2H-pyran-5-one.
What is the SMILES notation for 2-(4-hydroxy-2,6-dimethyloxan-3-yl)oxy-6-methyl-2H-pyran-5-one?
The canonical SMILES for 2-(4-hydroxy-2,6-dimethyloxan-3-yl)oxy-6-methyl-2H-pyran-5-one is CC1CC(O)C(OC2C=CC(=O)C(C)O2)C(C)O1.
What is the InChIKey of 2-(4-hydroxy-2,6-dimethyloxan-3-yl)oxy-6-methyl-2H-pyran-5-one?
The InChIKey is CAGSIDQRMHZANM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O5/c1-7-6-11(15)13(9(3)16-7)18-12-5-4-10(14)8(2)17-12/h4-5,7-9,11-13,15H,6H2,1-3H3.
What are the key properties of 2-(4-hydroxy-2,6-dimethyloxan-3-yl)oxy-6-methyl-2H-pyran-5-one?
2-(4-hydroxy-2,6-dimethyloxan-3-yl)oxy-6-methyl-2H-pyran-5-one has a molecular weight of 256.30 g/mol, XLogP of 0.80, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-hydroxy-2,6-dimethyloxan-3-yl)oxy-6-methyl-2H-pyran-5-one is sourced from PubChem (CID 90378484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).