About 2-[6-(4-hydroxy-2,6-dimethyloxan-3-yl)oxy-2-methyloxan-3-yl]oxy-6-methyl-2H-pyran-5-one
2-[6-(4-hydroxy-2,6-dimethyloxan-3-yl)oxy-2-methyloxan-3-yl]oxy-6-methyl-2H-pyran-5-one (PubChem CID 90378523) has the molecular formula C19H30O7
and a molecular weight of 370.44 g/mol. Its IUPAC name is 2-[6-(4-hydroxy-2,6-dimethyloxan-3-yl)oxy-2-methyloxan-3-yl]oxy-6-methyl-2H-pyran-5-one.
Molecular Properties
| Compound Name | 2-[6-(4-hydroxy-2,6-dimethyloxan-3-yl)oxy-2-methyloxan-3-yl]oxy-6-methyl-2H-pyran-5-one |
| PubChem CID | 90378523 |
| Molecular Formula | C19H30O7 |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 2-[6-(4-hydroxy-2,6-dimethyloxan-3-yl)oxy-2-methyloxan-3-yl]oxy-6-methyl-2H-pyran-5-one |
| SMILES | CC1CC(O)C(OC2CCC(OC3C=CC(=O)C(C)O3)C(C)O2)C(C)O1 |
| InChI | InChI=1S/C19H30O7/c1-10-9-15(21)19(13(4)22-10)26-18-8-6-16(12(3)24-18)25-17-7-5-14(20)11(2)23-17/h5,7,10-13,15-19,21H,6,8-9H2,1-4H3 |
| InChIKey | VKOGGFGAYMBNIE-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[6-(4-hydroxy-2,6-dimethyloxan-3-yl)oxy-2-methyloxan-3-yl]oxy-6-methyl-2H-pyran-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-(4-hydroxy-2,6-dimethyloxan-3-yl)oxy-2-methyloxan-3-yl]oxy-6-methyl-2H-pyran-5-one?
The IUPAC name of 2-[6-(4-hydroxy-2,6-dimethyloxan-3-yl)oxy-2-methyloxan-3-yl]oxy-6-methyl-2H-pyran-5-one (CID 90378523) is 2-[6-(4-hydroxy-2,6-dimethyloxan-3-yl)oxy-2-methyloxan-3-yl]oxy-6-methyl-2H-pyran-5-one.
What is the SMILES notation for 2-[6-(4-hydroxy-2,6-dimethyloxan-3-yl)oxy-2-methyloxan-3-yl]oxy-6-methyl-2H-pyran-5-one?
The canonical SMILES for 2-[6-(4-hydroxy-2,6-dimethyloxan-3-yl)oxy-2-methyloxan-3-yl]oxy-6-methyl-2H-pyran-5-one is CC1CC(O)C(OC2CCC(OC3C=CC(=O)C(C)O3)C(C)O2)C(C)O1.
What is the InChIKey of 2-[6-(4-hydroxy-2,6-dimethyloxan-3-yl)oxy-2-methyloxan-3-yl]oxy-6-methyl-2H-pyran-5-one?
The InChIKey is VKOGGFGAYMBNIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30O7/c1-10-9-15(21)19(13(4)22-10)26-18-8-6-16(12(3)24-18)25-17-7-5-14(20)11(2)23-17/h5,7,10-13,15-19,21H,6,8-9H2,1-4H3.
What are the key properties of 2-[6-(4-hydroxy-2,6-dimethyloxan-3-yl)oxy-2-methyloxan-3-yl]oxy-6-methyl-2H-pyran-5-one?
2-[6-(4-hydroxy-2,6-dimethyloxan-3-yl)oxy-2-methyloxan-3-yl]oxy-6-methyl-2H-pyran-5-one has a molecular weight of 370.44 g/mol, XLogP of 1.71, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-(4-hydroxy-2,6-dimethyloxan-3-yl)oxy-2-methyloxan-3-yl]oxy-6-methyl-2H-pyran-5-one is sourced from PubChem (CID 90378523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).