About 6-[[6-chloro-2-(2,3-dihydrothiophen-4-yl)-5-methyl-1H-indol-3-yl]methyl]pyridine-2-carboxylic acid
6-[[6-chloro-2-(2,3-dihydrothiophen-4-yl)-5-methyl-1H-indol-3-yl]methyl]pyridine-2-carboxylic acid (PubChem CID 90378969) has the molecular formula C20H17ClN2O2S
and a molecular weight of 384.89 g/mol. Its IUPAC name is 6-[[6-chloro-2-(2,3-dihydrothiophen-4-yl)-5-methyl-1H-indol-3-yl]methyl]pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 6-[[6-chloro-2-(2,3-dihydrothiophen-4-yl)-5-methyl-1H-indol-3-yl]methyl]pyridine-2-carboxylic acid |
| PubChem CID | 90378969 |
| Molecular Formula | C20H17ClN2O2S |
| Molecular Weight | 384.89 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 6-[[6-chloro-2-(2,3-dihydrothiophen-4-yl)-5-methyl-1H-indol-3-yl]methyl]pyridine-2-carboxylic acid |
| SMILES | Cc1cc2c(Cc3cccc(C(=O)O)n3)c(C3=CSCC3)[nH]c2cc1Cl |
| InChI | InChI=1S/C20H17ClN2O2S/c1-11-7-14-15(8-13-3-2-4-17(22-13)20(24)25)19(12-5-6-26-10-12)23-18(14)9-16(11)21/h2-4,7,9-10,23H,5-6,8H2,1H3,(H,24,25) |
| InChIKey | PAKVOMSDWCUJIZ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.89 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[[6-chloro-2-(2,3-dihydrothiophen-4-yl)-5-methyl-1H-indol-3-yl]methyl]pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[6-chloro-2-(2,3-dihydrothiophen-4-yl)-5-methyl-1H-indol-3-yl]methyl]pyridine-2-carboxylic acid?
The IUPAC name of 6-[[6-chloro-2-(2,3-dihydrothiophen-4-yl)-5-methyl-1H-indol-3-yl]methyl]pyridine-2-carboxylic acid (CID 90378969) is 6-[[6-chloro-2-(2,3-dihydrothiophen-4-yl)-5-methyl-1H-indol-3-yl]methyl]pyridine-2-carboxylic acid.
What is the SMILES notation for 6-[[6-chloro-2-(2,3-dihydrothiophen-4-yl)-5-methyl-1H-indol-3-yl]methyl]pyridine-2-carboxylic acid?
The canonical SMILES for 6-[[6-chloro-2-(2,3-dihydrothiophen-4-yl)-5-methyl-1H-indol-3-yl]methyl]pyridine-2-carboxylic acid is Cc1cc2c(Cc3cccc(C(=O)O)n3)c(C3=CSCC3)[nH]c2cc1Cl.
What is the InChIKey of 6-[[6-chloro-2-(2,3-dihydrothiophen-4-yl)-5-methyl-1H-indol-3-yl]methyl]pyridine-2-carboxylic acid?
The InChIKey is PAKVOMSDWCUJIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17ClN2O2S/c1-11-7-14-15(8-13-3-2-4-17(22-13)20(24)25)19(12-5-6-26-10-12)23-18(14)9-16(11)21/h2-4,7,9-10,23H,5-6,8H2,1H3,(H,24,25).
What are the key properties of 6-[[6-chloro-2-(2,3-dihydrothiophen-4-yl)-5-methyl-1H-indol-3-yl]methyl]pyridine-2-carboxylic acid?
6-[[6-chloro-2-(2,3-dihydrothiophen-4-yl)-5-methyl-1H-indol-3-yl]methyl]pyridine-2-carboxylic acid has a molecular weight of 384.89 g/mol, XLogP of 5.29, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[6-chloro-2-(2,3-dihydrothiophen-4-yl)-5-methyl-1H-indol-3-yl]methyl]pyridine-2-carboxylic acid is sourced from PubChem (CID 90378969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).