About 1-[(2,7-dihydroxynaphthalen-1-yl)-(4-phenylphenyl)methyl]naphthalene-2,7-diol
1-[(2,7-dihydroxynaphthalen-1-yl)-(4-phenylphenyl)methyl]naphthalene-2,7-diol (PubChem CID 90379061) has the molecular formula C33H24O4
and a molecular weight of 484.55 g/mol. Its IUPAC name is 1-[(2,7-dihydroxynaphthalen-1-yl)-(4-phenylphenyl)methyl]naphthalene-2,7-diol.
Molecular Properties
| Compound Name | 1-[(2,7-dihydroxynaphthalen-1-yl)-(4-phenylphenyl)methyl]naphthalene-2,7-diol |
| PubChem CID | 90379061 |
| Molecular Formula | C33H24O4 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 1-[(2,7-dihydroxynaphthalen-1-yl)-(4-phenylphenyl)methyl]naphthalene-2,7-diol |
| SMILES | Oc1ccc2ccc(O)c(C(c3ccc(-c4ccccc4)cc3)c3c(O)ccc4ccc(O)cc34)c2c1 |
| InChI | InChI=1S/C33H24O4/c34-25-14-10-22-12-16-29(36)32(27(22)18-25)31(24-8-6-21(7-9-24)20-4-2-1-3-5-20)33-28-19-26(35)15-11-23(28)13-17-30(33)37/h1-19,31,34-37H |
| InChIKey | YEFOEHAHFLYVPW-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2,7-dihydroxynaphthalen-1-yl)-(4-phenylphenyl)methyl]naphthalene-2,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,7-dihydroxynaphthalen-1-yl)-(4-phenylphenyl)methyl]naphthalene-2,7-diol?
The IUPAC name of 1-[(2,7-dihydroxynaphthalen-1-yl)-(4-phenylphenyl)methyl]naphthalene-2,7-diol (CID 90379061) is 1-[(2,7-dihydroxynaphthalen-1-yl)-(4-phenylphenyl)methyl]naphthalene-2,7-diol.
What is the SMILES notation for 1-[(2,7-dihydroxynaphthalen-1-yl)-(4-phenylphenyl)methyl]naphthalene-2,7-diol?
The canonical SMILES for 1-[(2,7-dihydroxynaphthalen-1-yl)-(4-phenylphenyl)methyl]naphthalene-2,7-diol is Oc1ccc2ccc(O)c(C(c3ccc(-c4ccccc4)cc3)c3c(O)ccc4ccc(O)cc34)c2c1.
What is the InChIKey of 1-[(2,7-dihydroxynaphthalen-1-yl)-(4-phenylphenyl)methyl]naphthalene-2,7-diol?
The InChIKey is YEFOEHAHFLYVPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H24O4/c34-25-14-10-22-12-16-29(36)32(27(22)18-25)31(24-8-6-21(7-9-24)20-4-2-1-3-5-20)33-28-19-26(35)15-11-23(28)13-17-30(33)37/h1-19,31,34-37H.
What are the key properties of 1-[(2,7-dihydroxynaphthalen-1-yl)-(4-phenylphenyl)methyl]naphthalene-2,7-diol?
1-[(2,7-dihydroxynaphthalen-1-yl)-(4-phenylphenyl)methyl]naphthalene-2,7-diol has a molecular weight of 484.55 g/mol, XLogP of 7.66, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,7-dihydroxynaphthalen-1-yl)-(4-phenylphenyl)methyl]naphthalene-2,7-diol is sourced from PubChem (CID 90379061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).