About ethyl 1-(cyclohexylmethyl)-2,5-dimethylpyrrole-3-carboxylate
ethyl 1-(cyclohexylmethyl)-2,5-dimethylpyrrole-3-carboxylate (PubChem CID 90379201) has the molecular formula C16H25NO2
and a molecular weight of 263.38 g/mol. Its IUPAC name is ethyl 1-(cyclohexylmethyl)-2,5-dimethylpyrrole-3-carboxylate.
Analyze ethyl 1-(cyclohexylmethyl)-2,5-dimethylpyrrole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-(cyclohexylmethyl)-2,5-dimethylpyrrole-3-carboxylate?
The IUPAC name of ethyl 1-(cyclohexylmethyl)-2,5-dimethylpyrrole-3-carboxylate (CID 90379201) is ethyl 1-(cyclohexylmethyl)-2,5-dimethylpyrrole-3-carboxylate.
What is the SMILES notation for ethyl 1-(cyclohexylmethyl)-2,5-dimethylpyrrole-3-carboxylate?
The canonical SMILES for ethyl 1-(cyclohexylmethyl)-2,5-dimethylpyrrole-3-carboxylate is CCOC(=O)c1cc(C)n(CC2CCCCC2)c1C.
What is the InChIKey of ethyl 1-(cyclohexylmethyl)-2,5-dimethylpyrrole-3-carboxylate?
The InChIKey is LVBMMECCXMDWLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO2/c1-4-19-16(18)15-10-12(2)17(13(15)3)11-14-8-6-5-7-9-14/h10,14H,4-9,11H2,1-3H3.
What are the key properties of ethyl 1-(cyclohexylmethyl)-2,5-dimethylpyrrole-3-carboxylate?
ethyl 1-(cyclohexylmethyl)-2,5-dimethylpyrrole-3-carboxylate has a molecular weight of 263.38 g/mol, XLogP of 3.86, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(cyclohexylmethyl)-2,5-dimethylpyrrole-3-carboxylate is sourced from PubChem (CID 90379201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).