About 6-tert-butyl-3,3-difluorocyclooctyne
6-tert-butyl-3,3-difluorocyclooctyne (PubChem CID 90379424) has the molecular formula C12H18F2
and a molecular weight of 200.27 g/mol. Its IUPAC name is 6-tert-butyl-3,3-difluorocyclooctyne.
Molecular Properties
| Compound Name | 6-tert-butyl-3,3-difluorocyclooctyne |
| PubChem CID | 90379424 |
| Molecular Formula | C12H18F2 |
| Molecular Weight | 200.27 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 6-tert-butyl-3,3-difluorocyclooctyne |
| SMILES | CC(C)(C)C1CCC#CC(F)(F)CC1 |
| InChI | InChI=1S/C12H18F2/c1-11(2,3)10-6-4-5-8-12(13,14)9-7-10/h10H,4,6-7,9H2,1-3H3 |
| InChIKey | FQWUTWNABPKMQZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.27 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-tert-butyl-3,3-difluorocyclooctyne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-3,3-difluorocyclooctyne?
The IUPAC name of 6-tert-butyl-3,3-difluorocyclooctyne (CID 90379424) is 6-tert-butyl-3,3-difluorocyclooctyne.
What is the SMILES notation for 6-tert-butyl-3,3-difluorocyclooctyne?
The canonical SMILES for 6-tert-butyl-3,3-difluorocyclooctyne is CC(C)(C)C1CCC#CC(F)(F)CC1.
What is the InChIKey of 6-tert-butyl-3,3-difluorocyclooctyne?
The InChIKey is FQWUTWNABPKMQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18F2/c1-11(2,3)10-6-4-5-8-12(13,14)9-7-10/h10H,4,6-7,9H2,1-3H3.
What are the key properties of 6-tert-butyl-3,3-difluorocyclooctyne?
6-tert-butyl-3,3-difluorocyclooctyne has a molecular weight of 200.27 g/mol, XLogP of 3.86, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-3,3-difluorocyclooctyne is sourced from PubChem (CID 90379424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).