C12H13F9O4 — CID 90379773
1,1,1-trifluoropropan-2-yl 2-[[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]methyl]prop-2-enoate (PubChem CID 90379773) has the molecular formula C12H13F9O4 and a molecular weight of 392.21 g/mol. Its IUPAC name is 1,1,1-trifluoropropan-2-yl 2-[[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]methyl]prop-2-enoate.
| Compound Name | 1,1,1-trifluoropropan-2-yl 2-[[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 90379773 |
| Molecular Formula | C12H13F9O4 |
| Molecular Weight | 392.21 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 1,1,1-trifluoropropan-2-yl 2-[[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]methyl]prop-2-enoate |
| SMILES | C=C(COCCC(O)(C(F)(F)F)C(F)(F)F)C(=O)OC(C)C(F)(F)F |
| InChI | InChI=1S/C12H13F9O4/c1-6(8(22)25-7(2)10(13,14)15)5-24-4-3-9(23,11(16,17)18)12(19,20)21/h7,23H,1,3-5H2,2H3 |
| InChIKey | DUUJJTXZEACORD-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.21 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|