About 2-[2,3-bis[2-(3-sulfanylpropanoyloxy)ethoxy]hexoxy]ethyl 3-sulfanylpropanoate
2-[2,3-bis[2-(3-sulfanylpropanoyloxy)ethoxy]hexoxy]ethyl 3-sulfanylpropanoate (PubChem CID 90379837) has the molecular formula C21H38O9S3
and a molecular weight of 530.73 g/mol. Its IUPAC name is 2-[2,3-bis[2-(3-sulfanylpropanoyloxy)ethoxy]hexoxy]ethyl 3-sulfanylpropanoate.
Molecular Properties
| Compound Name | 2-[2,3-bis[2-(3-sulfanylpropanoyloxy)ethoxy]hexoxy]ethyl 3-sulfanylpropanoate |
| PubChem CID | 90379837 |
| Molecular Formula | C21H38O9S3 |
| Molecular Weight | 530.73 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | 2-[2,3-bis[2-(3-sulfanylpropanoyloxy)ethoxy]hexoxy]ethyl 3-sulfanylpropanoate |
| SMILES | CCCC(OCCOC(=O)CCS)C(COCCOC(=O)CCS)OCCOC(=O)CCS |
| InChI | InChI=1S/C21H38O9S3/c1-2-3-17(26-9-11-29-20(23)5-14-32)18(27-10-12-30-21(24)6-15-33)16-25-7-8-28-19(22)4-13-31/h17-18,31-33H,2-16H2,1H3 |
| InChIKey | VROIFMXXYWPXSZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 106.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 530.73 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,3-bis[2-(3-sulfanylpropanoyloxy)ethoxy]hexoxy]ethyl 3-sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,3-bis[2-(3-sulfanylpropanoyloxy)ethoxy]hexoxy]ethyl 3-sulfanylpropanoate?
The IUPAC name of 2-[2,3-bis[2-(3-sulfanylpropanoyloxy)ethoxy]hexoxy]ethyl 3-sulfanylpropanoate (CID 90379837) is 2-[2,3-bis[2-(3-sulfanylpropanoyloxy)ethoxy]hexoxy]ethyl 3-sulfanylpropanoate.
What is the SMILES notation for 2-[2,3-bis[2-(3-sulfanylpropanoyloxy)ethoxy]hexoxy]ethyl 3-sulfanylpropanoate?
The canonical SMILES for 2-[2,3-bis[2-(3-sulfanylpropanoyloxy)ethoxy]hexoxy]ethyl 3-sulfanylpropanoate is CCCC(OCCOC(=O)CCS)C(COCCOC(=O)CCS)OCCOC(=O)CCS.
What is the InChIKey of 2-[2,3-bis[2-(3-sulfanylpropanoyloxy)ethoxy]hexoxy]ethyl 3-sulfanylpropanoate?
The InChIKey is VROIFMXXYWPXSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H38O9S3/c1-2-3-17(26-9-11-29-20(23)5-14-32)18(27-10-12-30-21(24)6-15-33)16-25-7-8-28-19(22)4-13-31/h17-18,31-33H,2-16H2,1H3.
What are the key properties of 2-[2,3-bis[2-(3-sulfanylpropanoyloxy)ethoxy]hexoxy]ethyl 3-sulfanylpropanoate?
2-[2,3-bis[2-(3-sulfanylpropanoyloxy)ethoxy]hexoxy]ethyl 3-sulfanylpropanoate has a molecular weight of 530.73 g/mol, XLogP of 2.16, 22 rotatable bonds, 3 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,3-bis[2-(3-sulfanylpropanoyloxy)ethoxy]hexoxy]ethyl 3-sulfanylpropanoate is sourced from PubChem (CID 90379837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).