C16H11ClN2O — CID 9038019
5-[(Z)-1-chloro-2-phenylethenyl]-3-phenyl-1,2,4-oxadiazole (PubChem CID 9038019) has the molecular formula C16H11ClN2O and a molecular weight of 282.73 g/mol. Its IUPAC name is 5-[(Z)-1-chloro-2-phenylethenyl]-3-phenyl-1,2,4-oxadiazole.
| Compound Name | 5-[(Z)-1-chloro-2-phenylethenyl]-3-phenyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 9038019 |
| Molecular Formula | C16H11ClN2O |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 5-[(Z)-1-chloro-2-phenylethenyl]-3-phenyl-1,2,4-oxadiazole |
| SMILES | Cl/C(=C\c1ccccc1)c1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C16H11ClN2O/c17-14(11-12-7-3-1-4-8-12)16-18-15(19-20-16)13-9-5-2-6-10-13/h1-11H/b14-11- |
| InChIKey | PGRZNKKWKAZDBI-KAMYIIQDSA-N |
| XLogP | 4.47 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |