C32H36F3NO4 — CID 90380227
2-[2,4-bis(3,4-dimethylphenyl)-3,6-dimethyl-5-[(2,2,2-trifluoroacetyl)amino]phenyl]-2-[(2-methylpropan-2-yl)oxy]acetic acid (PubChem CID 90380227) has the molecular formula C32H36F3NO4 and a molecular weight of 555.64 g/mol. Its IUPAC name is 2-[2,4-bis(3,4-dimethylphenyl)-3,6-dimethyl-5-[(2,2,2-trifluoroacetyl)amino]phenyl]-2-[(2-methylpropan-2-yl)oxy]acetic acid.
| Compound Name | 2-[2,4-bis(3,4-dimethylphenyl)-3,6-dimethyl-5-[(2,2,2-trifluoroacetyl)amino]phenyl]-2-[(2-methylpropan-2-yl)oxy]acetic acid |
|---|---|
| PubChem CID | 90380227 |
| Molecular Formula | C32H36F3NO4 |
| Molecular Weight | 555.64 g/mol |
| Exact Mass | 555.26 |
| IUPAC Name | 2-[2,4-bis(3,4-dimethylphenyl)-3,6-dimethyl-5-[(2,2,2-trifluoroacetyl)amino]phenyl]-2-[(2-methylpropan-2-yl)oxy]acetic acid |
| SMILES | Cc1ccc(-c2c(C)c(-c3ccc(C)c(C)c3)c(C(OC(C)(C)C)C(=O)O)c(C)c2NC(=O)C(F)(F)F)cc1C |
| InChI | InChI=1S/C32H36F3NO4/c1-16-10-12-22(14-18(16)3)24-20(5)25(23-13-11-17(2)19(4)15-23)27(36-30(39)32(33,34)35)21(6)26(24)28(29(37)38)40-31(7,8)9/h10-15,28H,1-9H3,(H,36,39)(H,37,38) |
| InChIKey | HERZYFYHQMYTBX-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.64 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |