C33H38F3NO4 — CID 90380228
methyl 2-[2,4-bis(3,4-dimethylphenyl)-3,6-dimethyl-5-[(2,2,2-trifluoroacetyl)amino]phenyl]-2-[(2-methylpropan-2-yl)oxy]acetate (PubChem CID 90380228) has the molecular formula C33H38F3NO4 and a molecular weight of 569.66 g/mol. Its IUPAC name is methyl 2-[2,4-bis(3,4-dimethylphenyl)-3,6-dimethyl-5-[(2,2,2-trifluoroacetyl)amino]phenyl]-2-[(2-methylpropan-2-yl)oxy]acetate.
| Compound Name | methyl 2-[2,4-bis(3,4-dimethylphenyl)-3,6-dimethyl-5-[(2,2,2-trifluoroacetyl)amino]phenyl]-2-[(2-methylpropan-2-yl)oxy]acetate |
|---|---|
| PubChem CID | 90380228 |
| Molecular Formula | C33H38F3NO4 |
| Molecular Weight | 569.66 g/mol |
| Exact Mass | 569.28 |
| IUPAC Name | methyl 2-[2,4-bis(3,4-dimethylphenyl)-3,6-dimethyl-5-[(2,2,2-trifluoroacetyl)amino]phenyl]-2-[(2-methylpropan-2-yl)oxy]acetate |
| SMILES | COC(=O)C(OC(C)(C)C)c1c(C)c(NC(=O)C(F)(F)F)c(-c2ccc(C)c(C)c2)c(C)c1-c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C33H38F3NO4/c1-17-11-13-23(15-19(17)3)25-21(5)26(24-14-12-18(2)20(4)16-24)28(37-31(39)33(34,35)36)22(6)27(25)29(30(38)40-10)41-32(7,8)9/h11-16,29H,1-10H3,(H,37,39) |
| InChIKey | LXVVVPCQEDWCQF-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.66 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |