C29H34BrNO3 — CID 90380432
2-[3-amino-2-bromo-4,6-bis(3,4-dimethylphenyl)-5-methylphenyl]-2-[(2-methylpropan-2-yl)oxy]acetic acid (PubChem CID 90380432) has the molecular formula C29H34BrNO3 and a molecular weight of 524.50 g/mol. Its IUPAC name is 2-[3-amino-2-bromo-4,6-bis(3,4-dimethylphenyl)-5-methylphenyl]-2-[(2-methylpropan-2-yl)oxy]acetic acid.
| Compound Name | 2-[3-amino-2-bromo-4,6-bis(3,4-dimethylphenyl)-5-methylphenyl]-2-[(2-methylpropan-2-yl)oxy]acetic acid |
|---|---|
| PubChem CID | 90380432 |
| Molecular Formula | C29H34BrNO3 |
| Molecular Weight | 524.50 g/mol |
| Exact Mass | 523.17 |
| IUPAC Name | 2-[3-amino-2-bromo-4,6-bis(3,4-dimethylphenyl)-5-methylphenyl]-2-[(2-methylpropan-2-yl)oxy]acetic acid |
| SMILES | Cc1ccc(-c2c(C)c(-c3ccc(C)c(C)c3)c(C(OC(C)(C)C)C(=O)O)c(Br)c2N)cc1C |
| InChI | InChI=1S/C29H34BrNO3/c1-15-9-11-20(13-17(15)3)22-19(5)23(21-12-10-16(2)18(4)14-21)26(31)25(30)24(22)27(28(32)33)34-29(6,7)8/h9-14,27H,31H2,1-8H3,(H,32,33) |
| InChIKey | VBDAFEYHAREQOI-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.50 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|