C62H50N4O8S2 — CID 90380756
2-methoxy-4-(N-[4-(N-[4-[4-(N-[4-(N-(3-methoxy-4-sulfophenyl)anilino)phenyl]anilino)phenyl]phenyl]anilino)phenyl]anilino)benzenesulfonic acid (PubChem CID 90380756) has the molecular formula C62H50N4O8S2 and a molecular weight of 1043.24 g/mol. Its IUPAC name is 2-methoxy-4-(N-[4-(N-[4-[4-(N-[4-(N-(3-methoxy-4-sulfophenyl)anilino)phenyl]anilino)phenyl]phenyl]anilino)phenyl]anilino)benzenesulfonic acid.
| Compound Name | 2-methoxy-4-(N-[4-(N-[4-[4-(N-[4-(N-(3-methoxy-4-sulfophenyl)anilino)phenyl]anilino)phenyl]phenyl]anilino)phenyl]anilino)benzenesulfonic acid |
|---|---|
| PubChem CID | 90380756 |
| Molecular Formula | C62H50N4O8S2 |
| Molecular Weight | 1043.24 g/mol |
| Exact Mass | 1042.31 |
| IUPAC Name | 2-methoxy-4-(N-[4-(N-[4-[4-(N-[4-(N-(3-methoxy-4-sulfophenyl)anilino)phenyl]anilino)phenyl]phenyl]anilino)phenyl]anilino)benzenesulfonic acid |
| SMILES | COc1cc(N(c2ccccc2)c2ccc(N(c3ccccc3)c3ccc(-c4ccc(N(c5ccccc5)c5ccc(N(c6ccccc6)c6ccc(S(=O)(=O)O)c(OC)c6)cc5)cc4)cc3)cc2)ccc1S(=O)(=O)O |
| InChI | InChI=1S/C62H50N4O8S2/c1-73-59-43-57(39-41-61(59)75(67,68)69)65(49-19-11-5-12-20-49)55-35-31-53(32-36-55)63(47-15-7-3-8-16-47)51-27-23-45(24-28-51)46-25-29-52(30-26-46)64(48-17-9-4-10-18-48)54-33-37-56(38-34-54)66(50-21-13-6-14-22-50)58-40-42-62(76(70,71)72)60(44-58)74-2/h3-44H,1-2H3,(H,67,68,69)(H,70,71,72) |
| InChIKey | JBOFHZORCZCJAR-UHFFFAOYSA-N |
| XLogP | 15.74 |
| TPSA | 140.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1043.24 |
| LogP ≤ 5 | 15.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|