C26H31N5O2S2 — CID 90381302
N-[4-[1-(2-pyridin-3-yl-1,3-thiazolidine-4-carbonyl)piperidin-4-yl]butyl]thieno[2,3-c]pyridine-2-carboxamide (PubChem CID 90381302) has the molecular formula C26H31N5O2S2 and a molecular weight of 509.70 g/mol. Its IUPAC name is N-[4-[1-(2-pyridin-3-yl-1,3-thiazolidine-4-carbonyl)piperidin-4-yl]butyl]thieno[2,3-c]pyridine-2-carboxamide.
| Compound Name | N-[4-[1-(2-pyridin-3-yl-1,3-thiazolidine-4-carbonyl)piperidin-4-yl]butyl]thieno[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 90381302 |
| Molecular Formula | C26H31N5O2S2 |
| Molecular Weight | 509.70 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | N-[4-[1-(2-pyridin-3-yl-1,3-thiazolidine-4-carbonyl)piperidin-4-yl]butyl]thieno[2,3-c]pyridine-2-carboxamide |
| SMILES | O=C(NCCCCC1CCN(C(=O)C2CSC(c3cccnc3)N2)CC1)c1cc2ccncc2s1 |
| InChI | InChI=1S/C26H31N5O2S2/c32-24(22-14-19-6-11-28-16-23(19)35-22)29-10-2-1-4-18-7-12-31(13-8-18)26(33)21-17-34-25(30-21)20-5-3-9-27-15-20/h3,5-6,9,11,14-16,18,21,25,30H,1-2,4,7-8,10,12-13,17H2,(H,29,32) |
| InChIKey | UMGJEQIRWMUJCY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.70 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|