About 5-azido-2-methylphenol
5-azido-2-methylphenol (PubChem CID 90382117) has the molecular formula C7H7N3O
and a molecular weight of 149.15 g/mol. Its IUPAC name is 5-azido-2-methylphenol.
Molecular Properties
| Compound Name | 5-azido-2-methylphenol |
| PubChem CID | 90382117 |
| Molecular Formula | C7H7N3O |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 5-azido-2-methylphenol |
| SMILES | Cc1ccc(N=[N+]=[N-])cc1O |
| InChI | InChI=1S/C7H7N3O/c1-5-2-3-6(9-10-8)4-7(5)11/h2-4,11H,1H3 |
| InChIKey | OKDUBUXKHNFJDI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 68.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 5-azido-2-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-azido-2-methylphenol?
The IUPAC name of 5-azido-2-methylphenol (CID 90382117) is 5-azido-2-methylphenol.
What is the SMILES notation for 5-azido-2-methylphenol?
The canonical SMILES for 5-azido-2-methylphenol is Cc1ccc(N=[N+]=[N-])cc1O.
What is the InChIKey of 5-azido-2-methylphenol?
The InChIKey is OKDUBUXKHNFJDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O/c1-5-2-3-6(9-10-8)4-7(5)11/h2-4,11H,1H3.
What are the key properties of 5-azido-2-methylphenol?
5-azido-2-methylphenol has a molecular weight of 149.15 g/mol, XLogP of 2.64, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-azido-2-methylphenol is sourced from PubChem (CID 90382117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).