About (Z)-4-N-ethylidenebut-3-ene-2,4-diimine
(Z)-4-N-ethylidenebut-3-ene-2,4-diimine (PubChem CID 90382157) has the molecular formula C6H10N2
and a molecular weight of 110.16 g/mol. Its IUPAC name is (Z)-4-N-ethylidenebut-3-ene-2,4-diimine.
Molecular Properties
| Compound Name | (Z)-4-N-ethylidenebut-3-ene-2,4-diimine |
| PubChem CID | 90382157 |
| Molecular Formula | C6H10N2 |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.08 |
| IUPAC Name | (Z)-4-N-ethylidenebut-3-ene-2,4-diimine |
| SMILES | [H]/N=C(C)/C=C\N=C\C |
| InChI | InChI=1S/C6H10N2/c1-3-8-5-4-6(2)7/h3-5,7H,1-2H3/b5-4-,7-6+,8-3+ |
| InChIKey | LAZXQEWLTIKEEA-FNXDBYPTSA-N |
| XLogP | 1.63 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-N-ethylidenebut-3-ene-2,4-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-N-ethylidenebut-3-ene-2,4-diimine?
The IUPAC name of (Z)-4-N-ethylidenebut-3-ene-2,4-diimine (CID 90382157) is (Z)-4-N-ethylidenebut-3-ene-2,4-diimine.
What is the SMILES notation for (Z)-4-N-ethylidenebut-3-ene-2,4-diimine?
The canonical SMILES for (Z)-4-N-ethylidenebut-3-ene-2,4-diimine is [H]/N=C(C)/C=C\N=C\C.
What is the InChIKey of (Z)-4-N-ethylidenebut-3-ene-2,4-diimine?
The InChIKey is LAZXQEWLTIKEEA-FNXDBYPTSA-N. The full InChI is InChI=1S/C6H10N2/c1-3-8-5-4-6(2)7/h3-5,7H,1-2H3/b5-4-,7-6+,8-3+.
What are the key properties of (Z)-4-N-ethylidenebut-3-ene-2,4-diimine?
(Z)-4-N-ethylidenebut-3-ene-2,4-diimine has a molecular weight of 110.16 g/mol, XLogP of 1.63, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-N-ethylidenebut-3-ene-2,4-diimine is sourced from PubChem (CID 90382157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).