About 3-ethylsulfonyl-4-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]benzoyl chloride
3-ethylsulfonyl-4-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]benzoyl chloride (PubChem CID 90382210) has the molecular formula C17H13ClF3N3O3S
and a molecular weight of 431.82 g/mol. Its IUPAC name is 3-ethylsulfonyl-4-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]benzoyl chloride.
Molecular Properties
| Compound Name | 3-ethylsulfonyl-4-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]benzoyl chloride |
| PubChem CID | 90382210 |
| Molecular Formula | C17H13ClF3N3O3S |
| Molecular Weight | 431.82 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | 3-ethylsulfonyl-4-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]benzoyl chloride |
| SMILES | CCS(=O)(=O)c1cc(C(=O)Cl)ccc1-c1nc2cc(C(F)(F)F)cnc2n1C |
| InChI | InChI=1S/C17H13ClF3N3O3S/c1-3-28(26,27)13-6-9(14(18)25)4-5-11(13)15-23-12-7-10(17(19,20)21)8-22-16(12)24(15)2/h4-8H,3H2,1-2H3 |
| InChIKey | HAJAZUVZMICEBY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 81.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.82 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-ethylsulfonyl-4-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]benzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylsulfonyl-4-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]benzoyl chloride?
The IUPAC name of 3-ethylsulfonyl-4-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]benzoyl chloride (CID 90382210) is 3-ethylsulfonyl-4-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]benzoyl chloride.
What is the SMILES notation for 3-ethylsulfonyl-4-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]benzoyl chloride?
The canonical SMILES for 3-ethylsulfonyl-4-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]benzoyl chloride is CCS(=O)(=O)c1cc(C(=O)Cl)ccc1-c1nc2cc(C(F)(F)F)cnc2n1C.
What is the InChIKey of 3-ethylsulfonyl-4-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]benzoyl chloride?
The InChIKey is HAJAZUVZMICEBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13ClF3N3O3S/c1-3-28(26,27)13-6-9(14(18)25)4-5-11(13)15-23-12-7-10(17(19,20)21)8-22-16(12)24(15)2/h4-8H,3H2,1-2H3.
What are the key properties of 3-ethylsulfonyl-4-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]benzoyl chloride?
3-ethylsulfonyl-4-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]benzoyl chloride has a molecular weight of 431.82 g/mol, XLogP of 3.83, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylsulfonyl-4-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]benzoyl chloride is sourced from PubChem (CID 90382210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).