C34H14F6N6O2 — CID 90382219
[20-cyanoimino-7,17-bis[4-(trifluoromethoxy)phenyl]-2,12-diazapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1,3(11),4(9),5,7,12,14(19),15,17-nonaen-10-ylidene]cyanamide (PubChem CID 90382219) has the molecular formula C34H14F6N6O2 and a molecular weight of 652.51 g/mol. Its IUPAC name is [20-cyanoimino-7,17-bis[4-(trifluoromethoxy)phenyl]-2,12-diazapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1,3(11),4(9),5,7,12,14(19),15,17-nonaen-10-ylidene]cyanamide.
| Compound Name | [20-cyanoimino-7,17-bis[4-(trifluoromethoxy)phenyl]-2,12-diazapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1,3(11),4(9),5,7,12,14(19),15,17-nonaen-10-ylidene]cyanamide |
|---|---|
| PubChem CID | 90382219 |
| Molecular Formula | C34H14F6N6O2 |
| Molecular Weight | 652.51 g/mol |
| Exact Mass | 652.11 |
| IUPAC Name | [20-cyanoimino-7,17-bis[4-(trifluoromethoxy)phenyl]-2,12-diazapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1,3(11),4(9),5,7,12,14(19),15,17-nonaen-10-ylidene]cyanamide |
| SMILES | N#C/N=c1\c2cc(-c3ccc(OC(F)(F)F)cc3)ccc2c2nc3/c(=N/C#N)c4cc(-c5ccc(OC(F)(F)F)cc5)ccc4c3nc12 |
| InChI | InChI=1S/C34H14F6N6O2/c35-33(36,37)47-21-7-1-17(2-8-21)19-5-11-23-25(13-19)27(43-15-41)31-29(23)45-32-28(44-16-42)26-14-20(6-12-24(26)30(32)46-31)18-3-9-22(10-4-18)48-34(38,39)40/h1-14H/b43-27+,44-28+ |
| InChIKey | LUFJCUCBKLBZFC-GCQSSKKOSA-N |
| XLogP | 7.86 |
| TPSA | 116.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.51 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|