C38H14F6N6O2 — CID 90382254
2-[20-(dicyanomethylidene)-7,17-bis[3-(trifluoromethoxy)phenyl]-2,12-diazapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1,3(11),4(9),5,7,12,14(19),15,17-nonaen-10-ylidene]propanedinitrile (PubChem CID 90382254) has the molecular formula C38H14F6N6O2 and a molecular weight of 700.56 g/mol. Its IUPAC name is 2-[20-(dicyanomethylidene)-7,17-bis[3-(trifluoromethoxy)phenyl]-2,12-diazapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1,3(11),4(9),5,7,12,14(19),15,17-nonaen-10-ylidene]propanedinitrile.
| Compound Name | 2-[20-(dicyanomethylidene)-7,17-bis[3-(trifluoromethoxy)phenyl]-2,12-diazapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1,3(11),4(9),5,7,12,14(19),15,17-nonaen-10-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 90382254 |
| Molecular Formula | C38H14F6N6O2 |
| Molecular Weight | 700.56 g/mol |
| Exact Mass | 700.11 |
| IUPAC Name | 2-[20-(dicyanomethylidene)-7,17-bis[3-(trifluoromethoxy)phenyl]-2,12-diazapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1,3(11),4(9),5,7,12,14(19),15,17-nonaen-10-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1c2cc(-c3cccc(OC(F)(F)F)c3)ccc2-c2nc3c(nc21)-c1ccc(-c2cccc(OC(F)(F)F)c2)cc1C3=C(C#N)C#N |
| InChI | InChI=1S/C38H14F6N6O2/c39-37(40,41)51-25-5-1-3-19(11-25)21-7-9-27-29(13-21)31(23(15-45)16-46)35-33(27)49-36-32(24(17-47)18-48)30-14-22(8-10-28(30)34(36)50-35)20-4-2-6-26(12-20)52-38(42,43)44/h1-14H |
| InChIKey | UUNYIDQSHKXXHC-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 139.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.56 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|