C23H48N6O — CID 90382620
N-(8-amino-3,6,10,13-tetrazabicyclo[6.6.6]icosan-1-yl)heptanamide (PubChem CID 90382620) has the molecular formula C23H48N6O and a molecular weight of 424.68 g/mol. Its IUPAC name is N-(8-amino-3,6,10,13-tetrazabicyclo[6.6.6]icosan-1-yl)heptanamide.
| Compound Name | N-(8-amino-3,6,10,13-tetrazabicyclo[6.6.6]icosan-1-yl)heptanamide |
|---|---|
| PubChem CID | 90382620 |
| Molecular Formula | C23H48N6O |
| Molecular Weight | 424.68 g/mol |
| Exact Mass | 424.39 |
| IUPAC Name | N-(8-amino-3,6,10,13-tetrazabicyclo[6.6.6]icosan-1-yl)heptanamide |
| SMILES | CCCCCCC(=O)NC12CCCCCCC(N)(CNCCNC1)CNCCNC2 |
| InChI | InChI=1S/C23H48N6O/c1-2-3-4-7-10-21(30)29-23-12-9-6-5-8-11-22(24,17-25-13-15-27-19-23)18-26-14-16-28-20-23/h25-28H,2-20,24H2,1H3,(H,29,30) |
| InChIKey | IQDOYHZXFCPIDA-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 103.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.68 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|