C22H18F4N6OS — CID 90383082
N-[2-(4-fluorophenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl]-1-methyl-4-[4-(trifluoromethyl)-1,3-thiazol-2-yl]pyrazole-5-carboxamide (PubChem CID 90383082) has the molecular formula C22H18F4N6OS and a molecular weight of 490.49 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl]-1-methyl-4-[4-(trifluoromethyl)-1,3-thiazol-2-yl]pyrazole-5-carboxamide.
| Compound Name | N-[2-(4-fluorophenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl]-1-methyl-4-[4-(trifluoromethyl)-1,3-thiazol-2-yl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 90383082 |
| Molecular Formula | C22H18F4N6OS |
| Molecular Weight | 490.49 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | N-[2-(4-fluorophenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl]-1-methyl-4-[4-(trifluoromethyl)-1,3-thiazol-2-yl]pyrazole-5-carboxamide |
| SMILES | Cn1ncc(-c2nc(C(F)(F)F)cs2)c1C(=O)NC1CCn2cc(-c3ccc(F)cc3)nc2C1 |
| InChI | InChI=1S/C22H18F4N6OS/c1-31-19(15(9-27-31)21-30-17(11-34-21)22(24,25)26)20(33)28-14-6-7-32-10-16(29-18(32)8-14)12-2-4-13(23)5-3-12/h2-5,9-11,14H,6-8H2,1H3,(H,28,33) |
| InChIKey | XLFHCLYYNRWCJJ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |