C23H23N7O2 — CID 90383093
4-(4-methoxy-2-pyridinyl)-1-methyl-N-(2-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl)pyrazole-5-carboxamide (PubChem CID 90383093) has the molecular formula C23H23N7O2 and a molecular weight of 429.48 g/mol. Its IUPAC name is 4-(4-methoxy-2-pyridinyl)-1-methyl-N-(2-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl)pyrazole-5-carboxamide.
| Compound Name | 4-(4-methoxy-2-pyridinyl)-1-methyl-N-(2-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 90383093 |
| Molecular Formula | C23H23N7O2 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 4-(4-methoxy-2-pyridinyl)-1-methyl-N-(2-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl)pyrazole-5-carboxamide |
| SMILES | COc1ccnc(-c2cnn(C)c2C(=O)NC2CCn3nc(-c4ccccc4)nc3C2)c1 |
| InChI | InChI=1S/C23H23N7O2/c1-29-21(18(14-25-29)19-13-17(32-2)8-10-24-19)23(31)26-16-9-11-30-20(12-16)27-22(28-30)15-6-4-3-5-7-15/h3-8,10,13-14,16H,9,11-12H2,1-2H3,(H,26,31) |
| InChIKey | IZOCSNAWARMHGO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 99.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |