C21H21N7OS — CID 90383107
1-methyl-4-(4-methyl-1,3-thiazol-2-yl)-N-(2-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl)pyrazole-5-carboxamide (PubChem CID 90383107) has the molecular formula C21H21N7OS and a molecular weight of 419.51 g/mol. Its IUPAC name is 1-methyl-4-(4-methyl-1,3-thiazol-2-yl)-N-(2-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl)pyrazole-5-carboxamide.
| Compound Name | 1-methyl-4-(4-methyl-1,3-thiazol-2-yl)-N-(2-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 90383107 |
| Molecular Formula | C21H21N7OS |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 1-methyl-4-(4-methyl-1,3-thiazol-2-yl)-N-(2-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl)pyrazole-5-carboxamide |
| SMILES | Cc1csc(-c2cnn(C)c2C(=O)NC2CCn3nc(-c4ccccc4)nc3C2)n1 |
| InChI | InChI=1S/C21H21N7OS/c1-13-12-30-21(23-13)16-11-22-27(2)18(16)20(29)24-15-8-9-28-17(10-15)25-19(26-28)14-6-4-3-5-7-14/h3-7,11-12,15H,8-10H2,1-2H3,(H,24,29) |
| InChIKey | OYYVCZQJFBGCRF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |