C23H20F3N7O — CID 90383124
1-methyl-N-(2-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl)-4-[6-(trifluoromethyl)-2-pyridinyl]pyrazole-5-carboxamide (PubChem CID 90383124) has the molecular formula C23H20F3N7O and a molecular weight of 467.46 g/mol. Its IUPAC name is 1-methyl-N-(2-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl)-4-[6-(trifluoromethyl)-2-pyridinyl]pyrazole-5-carboxamide.
| Compound Name | 1-methyl-N-(2-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl)-4-[6-(trifluoromethyl)-2-pyridinyl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 90383124 |
| Molecular Formula | C23H20F3N7O |
| Molecular Weight | 467.46 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 1-methyl-N-(2-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl)-4-[6-(trifluoromethyl)-2-pyridinyl]pyrazole-5-carboxamide |
| SMILES | Cn1ncc(-c2cccc(C(F)(F)F)n2)c1C(=O)NC1CCn2nc(-c3ccccc3)nc2C1 |
| InChI | InChI=1S/C23H20F3N7O/c1-32-20(16(13-27-32)17-8-5-9-18(29-17)23(24,25)26)22(34)28-15-10-11-33-19(12-15)30-21(31-33)14-6-3-2-4-7-14/h2-9,13,15H,10-12H2,1H3,(H,28,34) |
| InChIKey | QXHDOGUGAFQZML-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |