C21H18F3N7OS — CID 90383138
4-[4-(difluoromethyl)-1,3-thiazol-2-yl]-N-[2-(3-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl]-1-methylpyrazole-5-carboxamide (PubChem CID 90383138) has the molecular formula C21H18F3N7OS and a molecular weight of 473.48 g/mol. Its IUPAC name is 4-[4-(difluoromethyl)-1,3-thiazol-2-yl]-N-[2-(3-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl]-1-methylpyrazole-5-carboxamide.
| Compound Name | 4-[4-(difluoromethyl)-1,3-thiazol-2-yl]-N-[2-(3-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl]-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 90383138 |
| Molecular Formula | C21H18F3N7OS |
| Molecular Weight | 473.48 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | 4-[4-(difluoromethyl)-1,3-thiazol-2-yl]-N-[2-(3-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl]-1-methylpyrazole-5-carboxamide |
| SMILES | Cn1ncc(-c2nc(C(F)F)cs2)c1C(=O)NC1CCn2nc(-c3cccc(F)c3)nc2C1 |
| InChI | InChI=1S/C21H18F3N7OS/c1-30-17(14(9-25-30)21-27-15(10-33-21)18(23)24)20(32)26-13-5-6-31-16(8-13)28-19(29-31)11-3-2-4-12(22)7-11/h2-4,7,9-10,13,18H,5-6,8H2,1H3,(H,26,32) |
| InChIKey | SYZRDBJJRKRZRT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |