C22H19F3N6OS — CID 90383180
4-[4-(difluoromethyl)-1,3-thiazol-2-yl]-N-[2-(3-fluorophenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl]-1-methylpyrazole-5-carboxamide (PubChem CID 90383180) has the molecular formula C22H19F3N6OS and a molecular weight of 472.50 g/mol. Its IUPAC name is 4-[4-(difluoromethyl)-1,3-thiazol-2-yl]-N-[2-(3-fluorophenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl]-1-methylpyrazole-5-carboxamide.
| Compound Name | 4-[4-(difluoromethyl)-1,3-thiazol-2-yl]-N-[2-(3-fluorophenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl]-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 90383180 |
| Molecular Formula | C22H19F3N6OS |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | 4-[4-(difluoromethyl)-1,3-thiazol-2-yl]-N-[2-(3-fluorophenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl]-1-methylpyrazole-5-carboxamide |
| SMILES | Cn1ncc(-c2nc(C(F)F)cs2)c1C(=O)NC1CCn2cc(-c3cccc(F)c3)nc2C1 |
| InChI | InChI=1S/C22H19F3N6OS/c1-30-19(15(9-26-30)22-29-17(11-33-22)20(24)25)21(32)27-14-5-6-31-10-16(28-18(31)8-14)12-3-2-4-13(23)7-12/h2-4,7,9-11,14,20H,5-6,8H2,1H3,(H,27,32) |
| InChIKey | NQHWVOUWLQXDQM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |