About methyl 4-[4-(difluoromethyl)-1,3-thiazol-2-yl]-1-methylpyrazole-5-carboxylate
methyl 4-[4-(difluoromethyl)-1,3-thiazol-2-yl]-1-methylpyrazole-5-carboxylate (PubChem CID 90383211) has the molecular formula C10H9F2N3O2S
and a molecular weight of 273.26 g/mol. Its IUPAC name is methyl 4-[4-(difluoromethyl)-1,3-thiazol-2-yl]-1-methylpyrazole-5-carboxylate.
Molecular Properties
| Compound Name | methyl 4-[4-(difluoromethyl)-1,3-thiazol-2-yl]-1-methylpyrazole-5-carboxylate |
| PubChem CID | 90383211 |
| Molecular Formula | C10H9F2N3O2S |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | methyl 4-[4-(difluoromethyl)-1,3-thiazol-2-yl]-1-methylpyrazole-5-carboxylate |
| SMILES | COC(=O)c1c(-c2nc(C(F)F)cs2)cnn1C |
| InChI | InChI=1S/C10H9F2N3O2S/c1-15-7(10(16)17-2)5(3-13-15)9-14-6(4-18-9)8(11)12/h3-4,8H,1-2H3 |
| InChIKey | CJCIQQDCWKOERK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 4-[4-(difluoromethyl)-1,3-thiazol-2-yl]-1-methylpyrazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[4-(difluoromethyl)-1,3-thiazol-2-yl]-1-methylpyrazole-5-carboxylate?
The IUPAC name of methyl 4-[4-(difluoromethyl)-1,3-thiazol-2-yl]-1-methylpyrazole-5-carboxylate (CID 90383211) is methyl 4-[4-(difluoromethyl)-1,3-thiazol-2-yl]-1-methylpyrazole-5-carboxylate.
What is the SMILES notation for methyl 4-[4-(difluoromethyl)-1,3-thiazol-2-yl]-1-methylpyrazole-5-carboxylate?
The canonical SMILES for methyl 4-[4-(difluoromethyl)-1,3-thiazol-2-yl]-1-methylpyrazole-5-carboxylate is COC(=O)c1c(-c2nc(C(F)F)cs2)cnn1C.
What is the InChIKey of methyl 4-[4-(difluoromethyl)-1,3-thiazol-2-yl]-1-methylpyrazole-5-carboxylate?
The InChIKey is CJCIQQDCWKOERK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F2N3O2S/c1-15-7(10(16)17-2)5(3-13-15)9-14-6(4-18-9)8(11)12/h3-4,8H,1-2H3.
What are the key properties of methyl 4-[4-(difluoromethyl)-1,3-thiazol-2-yl]-1-methylpyrazole-5-carboxylate?
methyl 4-[4-(difluoromethyl)-1,3-thiazol-2-yl]-1-methylpyrazole-5-carboxylate has a molecular weight of 273.26 g/mol, XLogP of 2.27, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[4-(difluoromethyl)-1,3-thiazol-2-yl]-1-methylpyrazole-5-carboxylate is sourced from PubChem (CID 90383211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).