C22H21F2N7O2S — CID 90383417
4-[4-(difluoromethyl)-1,3-thiazol-2-yl]-N-[2-(2-methoxyphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl]-1-methylpyrazole-5-carboxamide (PubChem CID 90383417) has the molecular formula C22H21F2N7O2S and a molecular weight of 485.52 g/mol. Its IUPAC name is 4-[4-(difluoromethyl)-1,3-thiazol-2-yl]-N-[2-(2-methoxyphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl]-1-methylpyrazole-5-carboxamide.
| Compound Name | 4-[4-(difluoromethyl)-1,3-thiazol-2-yl]-N-[2-(2-methoxyphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl]-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 90383417 |
| Molecular Formula | C22H21F2N7O2S |
| Molecular Weight | 485.52 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | 4-[4-(difluoromethyl)-1,3-thiazol-2-yl]-N-[2-(2-methoxyphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl]-1-methylpyrazole-5-carboxamide |
| SMILES | COc1ccccc1-c1nc2n(n1)CCC(NC(=O)c1c(-c3nc(C(F)F)cs3)cnn1C)C2 |
| InChI | InChI=1S/C22H21F2N7O2S/c1-30-18(14(10-25-30)22-27-15(11-34-22)19(23)24)21(32)26-12-7-8-31-17(9-12)28-20(29-31)13-5-3-4-6-16(13)33-2/h3-6,10-12,19H,7-9H2,1-2H3,(H,26,32) |
| InChIKey | DLSZBKNDDKLMQQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 99.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |