C22H23N7OS — CID 90383426
4-(2,5-dimethyl-1,3-thiazol-4-yl)-1-methyl-N-(2-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl)pyrazole-5-carboxamide (PubChem CID 90383426) has the molecular formula C22H23N7OS and a molecular weight of 433.54 g/mol. Its IUPAC name is 4-(2,5-dimethyl-1,3-thiazol-4-yl)-1-methyl-N-(2-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl)pyrazole-5-carboxamide.
| Compound Name | 4-(2,5-dimethyl-1,3-thiazol-4-yl)-1-methyl-N-(2-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 90383426 |
| Molecular Formula | C22H23N7OS |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 4-(2,5-dimethyl-1,3-thiazol-4-yl)-1-methyl-N-(2-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl)pyrazole-5-carboxamide |
| SMILES | Cc1nc(-c2cnn(C)c2C(=O)NC2CCn3nc(-c4ccccc4)nc3C2)c(C)s1 |
| InChI | InChI=1S/C22H23N7OS/c1-13-19(24-14(2)31-13)17-12-23-28(3)20(17)22(30)25-16-9-10-29-18(11-16)26-21(27-29)15-7-5-4-6-8-15/h4-8,12,16H,9-11H2,1-3H3,(H,25,30) |
| InChIKey | OXKMZFXCLYUIFU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |