About (2R)-1-fluoro-2,3-dimethoxypropane
(2R)-1-fluoro-2,3-dimethoxypropane (PubChem CID 90383710) has the molecular formula C5H11FO2
and a molecular weight of 122.14 g/mol. Its IUPAC name is (2R)-1-fluoro-2,3-dimethoxypropane.
Molecular Properties
| Compound Name | (2R)-1-fluoro-2,3-dimethoxypropane |
| PubChem CID | 90383710 |
| Molecular Formula | C5H11FO2 |
| Molecular Weight | 122.14 g/mol |
| Exact Mass | 122.07 |
| IUPAC Name | (2R)-1-fluoro-2,3-dimethoxypropane |
| SMILES | COC[C@H](CF)OC |
| InChI | InChI=1S/C5H11FO2/c1-7-4-5(3-6)8-2/h5H,3-4H2,1-2H3/t5-/m0/s1 |
| InChIKey | KMWMBTIZQDOOOH-YFKPBYRVSA-N |
| XLogP | 0.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.14 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-1-fluoro-2,3-dimethoxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-fluoro-2,3-dimethoxypropane?
The IUPAC name of (2R)-1-fluoro-2,3-dimethoxypropane (CID 90383710) is (2R)-1-fluoro-2,3-dimethoxypropane.
What is the SMILES notation for (2R)-1-fluoro-2,3-dimethoxypropane?
The canonical SMILES for (2R)-1-fluoro-2,3-dimethoxypropane is COC[C@H](CF)OC.
What is the InChIKey of (2R)-1-fluoro-2,3-dimethoxypropane?
The InChIKey is KMWMBTIZQDOOOH-YFKPBYRVSA-N. The full InChI is InChI=1S/C5H11FO2/c1-7-4-5(3-6)8-2/h5H,3-4H2,1-2H3/t5-/m0/s1.
What are the key properties of (2R)-1-fluoro-2,3-dimethoxypropane?
(2R)-1-fluoro-2,3-dimethoxypropane has a molecular weight of 122.14 g/mol, XLogP of 0.62, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-fluoro-2,3-dimethoxypropane is sourced from PubChem (CID 90383710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).