C12H15N3O12S3 — CID 90383848
[3,5-bis(ethenylsulfonyloxymethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]methyl ethenesulfonate (PubChem CID 90383848) has the molecular formula C12H15N3O12S3 and a molecular weight of 489.46 g/mol. Its IUPAC name is [3,5-bis(ethenylsulfonyloxymethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]methyl ethenesulfonate.
| Compound Name | [3,5-bis(ethenylsulfonyloxymethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]methyl ethenesulfonate |
|---|---|
| PubChem CID | 90383848 |
| Molecular Formula | C12H15N3O12S3 |
| Molecular Weight | 489.46 g/mol |
| Exact Mass | 488.98 |
| IUPAC Name | [3,5-bis(ethenylsulfonyloxymethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]methyl ethenesulfonate |
| SMILES | C=CS(=O)(=O)OCn1c(=O)n(COS(=O)(=O)C=C)c(=O)n(COS(=O)(=O)C=C)c1=O |
| InChI | InChI=1S/C12H15N3O12S3/c1-4-28(19,20)25-7-13-10(16)14(8-26-29(21,22)5-2)12(18)15(11(13)17)9-27-30(23,24)6-3/h4-6H,1-3,7-9H2 |
| InChIKey | KFJMBTLUFRUKMN-UHFFFAOYSA-N |
| XLogP | -2.49 |
| TPSA | 196.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.46 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|