C28H24F2N2O4S — CID 90384240
(2S)-1-[3-[[4-[2-(2-cyanoethylsulfanyl)-4,5-difluorophenyl]phenoxy]methyl]benzoyl]pyrrolidine-2-carboxylic acid (PubChem CID 90384240) has the molecular formula C28H24F2N2O4S and a molecular weight of 522.57 g/mol. Its IUPAC name is (2S)-1-[3-[[4-[2-(2-cyanoethylsulfanyl)-4,5-difluorophenyl]phenoxy]methyl]benzoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[3-[[4-[2-(2-cyanoethylsulfanyl)-4,5-difluorophenyl]phenoxy]methyl]benzoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 90384240 |
| Molecular Formula | C28H24F2N2O4S |
| Molecular Weight | 522.57 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | (2S)-1-[3-[[4-[2-(2-cyanoethylsulfanyl)-4,5-difluorophenyl]phenoxy]methyl]benzoyl]pyrrolidine-2-carboxylic acid |
| SMILES | N#CCCSc1cc(F)c(F)cc1-c1ccc(OCc2cccc(C(=O)N3CCC[C@H]3C(=O)O)c2)cc1 |
| InChI | InChI=1S/C28H24F2N2O4S/c29-23-15-22(26(16-24(23)30)37-13-3-11-31)19-7-9-21(10-8-19)36-17-18-4-1-5-20(14-18)27(33)32-12-2-6-25(32)28(34)35/h1,4-5,7-10,14-16,25H,2-3,6,12-13,17H2,(H,34,35)/t25-/m0/s1 |
| InChIKey | ICCKRIIYISQTAU-VWLOTQADSA-N |
| XLogP | 5.91 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.57 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|