About 1-bromo-4,5-difluoro-2-methylsulfanylbenzene
1-bromo-4,5-difluoro-2-methylsulfanylbenzene (PubChem CID 90384264) has the molecular formula C7H5BrF2S
and a molecular weight of 239.08 g/mol. Its IUPAC name is 1-bromo-4,5-difluoro-2-methylsulfanylbenzene.
Molecular Properties
| Compound Name | 1-bromo-4,5-difluoro-2-methylsulfanylbenzene |
| PubChem CID | 90384264 |
| Molecular Formula | C7H5BrF2S |
| Molecular Weight | 239.08 g/mol |
| Exact Mass | 237.93 |
| IUPAC Name | 1-bromo-4,5-difluoro-2-methylsulfanylbenzene |
| SMILES | CSc1cc(F)c(F)cc1Br |
| InChI | InChI=1S/C7H5BrF2S/c1-11-7-3-6(10)5(9)2-4(7)8/h2-3H,1H3 |
| InChIKey | LICKLILGJPJQTH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.08 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-4,5-difluoro-2-methylsulfanylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4,5-difluoro-2-methylsulfanylbenzene?
The IUPAC name of 1-bromo-4,5-difluoro-2-methylsulfanylbenzene (CID 90384264) is 1-bromo-4,5-difluoro-2-methylsulfanylbenzene.
What is the SMILES notation for 1-bromo-4,5-difluoro-2-methylsulfanylbenzene?
The canonical SMILES for 1-bromo-4,5-difluoro-2-methylsulfanylbenzene is CSc1cc(F)c(F)cc1Br.
What is the InChIKey of 1-bromo-4,5-difluoro-2-methylsulfanylbenzene?
The InChIKey is LICKLILGJPJQTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrF2S/c1-11-7-3-6(10)5(9)2-4(7)8/h2-3H,1H3.
What are the key properties of 1-bromo-4,5-difluoro-2-methylsulfanylbenzene?
1-bromo-4,5-difluoro-2-methylsulfanylbenzene has a molecular weight of 239.08 g/mol, XLogP of 3.45, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4,5-difluoro-2-methylsulfanylbenzene is sourced from PubChem (CID 90384264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).