About (7-bromo-4,5-difluoro-1-benzofuran-3-yl)methanol
(7-bromo-4,5-difluoro-1-benzofuran-3-yl)methanol (PubChem CID 90384337) has the molecular formula C9H5BrF2O2
and a molecular weight of 263.04 g/mol. Its IUPAC name is (7-bromo-4,5-difluoro-1-benzofuran-3-yl)methanol.
Molecular Properties
| Compound Name | (7-bromo-4,5-difluoro-1-benzofuran-3-yl)methanol |
| PubChem CID | 90384337 |
| Molecular Formula | C9H5BrF2O2 |
| Molecular Weight | 263.04 g/mol |
| Exact Mass | 261.94 |
| IUPAC Name | (7-bromo-4,5-difluoro-1-benzofuran-3-yl)methanol |
| SMILES | OCc1coc2c(Br)cc(F)c(F)c12 |
| InChI | InChI=1S/C9H5BrF2O2/c10-5-1-6(11)8(12)7-4(2-13)3-14-9(5)7/h1,3,13H,2H2 |
| InChIKey | PGOZQEXFXAYZPI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.04 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze (7-bromo-4,5-difluoro-1-benzofuran-3-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-bromo-4,5-difluoro-1-benzofuran-3-yl)methanol?
The IUPAC name of (7-bromo-4,5-difluoro-1-benzofuran-3-yl)methanol (CID 90384337) is (7-bromo-4,5-difluoro-1-benzofuran-3-yl)methanol.
What is the SMILES notation for (7-bromo-4,5-difluoro-1-benzofuran-3-yl)methanol?
The canonical SMILES for (7-bromo-4,5-difluoro-1-benzofuran-3-yl)methanol is OCc1coc2c(Br)cc(F)c(F)c12.
What is the InChIKey of (7-bromo-4,5-difluoro-1-benzofuran-3-yl)methanol?
The InChIKey is PGOZQEXFXAYZPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5BrF2O2/c10-5-1-6(11)8(12)7-4(2-13)3-14-9(5)7/h1,3,13H,2H2.
What are the key properties of (7-bromo-4,5-difluoro-1-benzofuran-3-yl)methanol?
(7-bromo-4,5-difluoro-1-benzofuran-3-yl)methanol has a molecular weight of 263.04 g/mol, XLogP of 2.97, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7-bromo-4,5-difluoro-1-benzofuran-3-yl)methanol is sourced from PubChem (CID 90384337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).