C18H23Cl2NO3 — CID 90384368
(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 4-amino-3,5-dichloro-2-methoxybenzoate (PubChem CID 90384368) has the molecular formula C18H23Cl2NO3 and a molecular weight of 372.29 g/mol. Its IUPAC name is (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 4-amino-3,5-dichloro-2-methoxybenzoate.
| Compound Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 4-amino-3,5-dichloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 90384368 |
| Molecular Formula | C18H23Cl2NO3 |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 4-amino-3,5-dichloro-2-methoxybenzoate |
| SMILES | COc1c(C(=O)OC2CC3CCC2(C)C3(C)C)cc(Cl)c(N)c1Cl |
| InChI | InChI=1S/C18H23Cl2NO3/c1-17(2)9-5-6-18(17,3)12(7-9)24-16(22)10-8-11(19)14(21)13(20)15(10)23-4/h8-9,12H,5-7,21H2,1-4H3 |
| InChIKey | NIEMABXBPBBROK-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|