C25H27ClF3NO4 — CID 90384470
5-[[3-chloro-2-hydroxy-5-(trifluoromethyl)phenyl]methylamino]-2-hydroxy-3-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)benzoic acid (PubChem CID 90384470) has the molecular formula C25H27ClF3NO4 and a molecular weight of 497.94 g/mol. Its IUPAC name is 5-[[3-chloro-2-hydroxy-5-(trifluoromethyl)phenyl]methylamino]-2-hydroxy-3-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)benzoic acid.
| Compound Name | 5-[[3-chloro-2-hydroxy-5-(trifluoromethyl)phenyl]methylamino]-2-hydroxy-3-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)benzoic acid |
|---|---|
| PubChem CID | 90384470 |
| Molecular Formula | C25H27ClF3NO4 |
| Molecular Weight | 497.94 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | 5-[[3-chloro-2-hydroxy-5-(trifluoromethyl)phenyl]methylamino]-2-hydroxy-3-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)benzoic acid |
| SMILES | CC1(C)C2CCC1(C)C(c1cc(NCc3cc(C(F)(F)F)cc(Cl)c3O)cc(C(=O)O)c1O)C2 |
| InChI | InChI=1S/C25H27ClF3NO4/c1-23(2)13-4-5-24(23,3)18(7-13)16-9-15(10-17(21(16)32)22(33)34)30-11-12-6-14(25(27,28)29)8-19(26)20(12)31/h6,8-10,13,18,30-32H,4-5,7,11H2,1-3H3,(H,33,34) |
| InChIKey | RYCFZQFAAFCASZ-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.94 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|