C27H30FN3O2 — CID 90384512
[(1R,3S,9S,10R)-20-(2-fluoroethyl)-15-hydroxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-5-yl]-pyridin-2-ylmethanone (PubChem CID 90384512) has the molecular formula C27H30FN3O2 and a molecular weight of 447.55 g/mol. Its IUPAC name is [(1R,3S,9S,10R)-20-(2-fluoroethyl)-15-hydroxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-5-yl]-pyridin-2-ylmethanone.
| Compound Name | [(1R,3S,9S,10R)-20-(2-fluoroethyl)-15-hydroxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-5-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 90384512 |
| Molecular Formula | C27H30FN3O2 |
| Molecular Weight | 447.55 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | [(1R,3S,9S,10R)-20-(2-fluoroethyl)-15-hydroxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-5-yl]-pyridin-2-ylmethanone |
| SMILES | O=C(c1ccccn1)N1C[C@H]2C[C@@]34CCC1C2[C@@]31CCN(CCF)[C@@H]4Cc2ccc(O)cc21 |
| InChI | InChI=1S/C27H30FN3O2/c28-9-12-30-11-8-27-20-14-19(32)5-4-17(20)13-23(30)26(27)7-6-22-24(27)18(15-26)16-31(22)25(33)21-3-1-2-10-29-21/h1-5,10,14,18,22-24,32H,6-9,11-13,15-16H2/t18-,22?,23-,24?,26-,27+/m1/s1 |
| InChIKey | DNKOLGJYBIIWDA-TVPBTDIOSA-N |
| XLogP | 3.57 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.55 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |